C23H29BrN4 — CID 22249497
10-(2-bromo-4,6-dimethylphenyl)-7,11-dimethyl-3-pentan-2-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 22249497) has the molecular formula C23H29BrN4 and a molecular weight of 441.42 g/mol. Its IUPAC name is 10-(2-bromo-4,6-dimethylphenyl)-7,11-dimethyl-3-pentan-2-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 10-(2-bromo-4,6-dimethylphenyl)-7,11-dimethyl-3-pentan-2-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 22249497 |
| Molecular Formula | C23H29BrN4 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 10-(2-bromo-4,6-dimethylphenyl)-7,11-dimethyl-3-pentan-2-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | CCCC(C)N1CCc2c(C)nc3c(-c4c(C)cc(C)cc4Br)c(C)nn3c21 |
| InChI | InChI=1S/C23H29BrN4/c1-7-8-15(4)27-10-9-18-16(5)25-22-21(17(6)26-28(22)23(18)27)20-14(3)11-13(2)12-19(20)24/h11-12,15H,7-10H2,1-6H3 |
| InChIKey | VRMGLMPQVJNTSF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |