C26H30N4 — CID 22249901
3-butyl-7,11-dimethyl-4-prop-1-ynyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 22249901) has the molecular formula C26H30N4 and a molecular weight of 398.55 g/mol. Its IUPAC name is 3-butyl-7,11-dimethyl-4-prop-1-ynyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 3-butyl-7,11-dimethyl-4-prop-1-ynyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 22249901 |
| Molecular Formula | C26H30N4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 3-butyl-7,11-dimethyl-4-prop-1-ynyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | CC#Cc1cc2c(C)nc3c(-c4c(C)cc(C)cc4C)c(C)nn3c2n1CCCC |
| InChI | InChI=1S/C26H30N4/c1-8-10-12-29-21(11-9-2)15-22-19(6)27-25-24(20(7)28-30(25)26(22)29)23-17(4)13-16(3)14-18(23)5/h13-15H,8,10,12H2,1-7H3 |
| InChIKey | VRQCGJCGDCNRRK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|