C25H31N5O2 — CID 22249915
2-[2-(7,11-dimethyl-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-10-yl)-3,5-dimethylphenoxy]acetamide (PubChem CID 22249915) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[2-(7,11-dimethyl-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-10-yl)-3,5-dimethylphenoxy]acetamide.
| Compound Name | 2-[2-(7,11-dimethyl-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-10-yl)-3,5-dimethylphenoxy]acetamide |
|---|---|
| PubChem CID | 22249915 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-[2-(7,11-dimethyl-3-pentan-3-yl-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-10-yl)-3,5-dimethylphenoxy]acetamide |
| SMILES | CCC(CC)n1ccc2c(C)nc3c(-c4c(C)cc(C)cc4OCC(N)=O)c(C)nn3c21 |
| InChI | InChI=1S/C25H31N5O2/c1-7-18(8-2)29-10-9-19-16(5)27-24-23(17(6)28-30(24)25(19)29)22-15(4)11-14(3)12-20(22)32-13-21(26)31/h9-12,18H,7-8,13H2,1-6H3,(H2,26,31) |
| InChIKey | UEGQETLZOIXSDJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |