C25H24N4 — CID 22249955
7,11-dimethyl-3-phenyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 22249955) has the molecular formula C25H24N4 and a molecular weight of 380.50 g/mol. Its IUPAC name is 7,11-dimethyl-3-phenyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 7,11-dimethyl-3-phenyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 22249955 |
| Molecular Formula | C25H24N4 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 7,11-dimethyl-3-phenyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | Cc1cc(C)c(-c2c(C)nn3c2nc(C)c2ccn(-c4ccccc4)c23)c(C)c1 |
| InChI | InChI=1S/C25H24N4/c1-15-13-16(2)22(17(3)14-15)23-19(5)27-29-24(23)26-18(4)21-11-12-28(25(21)29)20-9-7-6-8-10-20/h6-14H,1-5H3 |
| InChIKey | LMLRHWBQLUZFSC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |