C10H5F2NO3 — CID 22250275
2,2-difluoro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-one (PubChem CID 22250275) has the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. Its IUPAC name is 2,2-difluoro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-one.
| Compound Name | 2,2-difluoro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
|---|---|
| PubChem CID | 22250275 |
| Molecular Formula | C10H5F2NO3 |
| Molecular Weight | 225.15 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2,2-difluoro-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
| SMILES | O=c1[nH]ccc2cc3c(cc12)OC(F)(F)O3 |
| InChI | InChI=1S/C10H5F2NO3/c11-10(12)15-7-3-5-1-2-13-9(14)6(5)4-8(7)16-10/h1-4H,(H,13,14) |
| InChIKey | IFUZQWLNWYCGRT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |