About chlorobenzene;1,2-dichlorobenzene
chlorobenzene;1,2-dichlorobenzene (PubChem CID 22250607) has the molecular formula C12H9Cl3
and a molecular weight of 259.56 g/mol. Its IUPAC name is chlorobenzene;1,2-dichlorobenzene.
Molecular Properties
| Compound Name | chlorobenzene;1,2-dichlorobenzene |
| PubChem CID | 22250607 |
| Molecular Formula | C12H9Cl3 |
| Molecular Weight | 259.56 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | chlorobenzene;1,2-dichlorobenzene |
| SMILES | Clc1ccccc1.Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2.C6H5Cl/c7-5-3-1-2-4-6(5)8;7-6-4-2-1-3-5-6/h1-4H;1-5H |
| InChIKey | SZRUMHWRJNVJJC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chlorobenzene;1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;1,2-dichlorobenzene?
The IUPAC name of chlorobenzene;1,2-dichlorobenzene (CID 22250607) is chlorobenzene;1,2-dichlorobenzene.
What is the SMILES notation for chlorobenzene;1,2-dichlorobenzene?
The canonical SMILES for chlorobenzene;1,2-dichlorobenzene is Clc1ccccc1.Clc1ccccc1Cl.
What is the InChIKey of chlorobenzene;1,2-dichlorobenzene?
The InChIKey is SZRUMHWRJNVJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.C6H5Cl/c7-5-3-1-2-4-6(5)8;7-6-4-2-1-3-5-6/h1-4H;1-5H.
What are the key properties of chlorobenzene;1,2-dichlorobenzene?
chlorobenzene;1,2-dichlorobenzene has a molecular weight of 259.56 g/mol, XLogP of 5.33, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;1,2-dichlorobenzene is sourced from PubChem (CID 22250607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).