C6H7N3O3 — CID 22250746
1-prop-2-enyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 22250746) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 1-prop-2-enyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 22250746 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 1-prop-2-enyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H7N3O3/c1-2-3-9-5(11)7-4(10)8-6(9)12/h2H,1,3H2,(H2,7,8,10,11,12) |
| InChIKey | KLUMROWVGFRESW-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|