About 1,1-dipropoxycyclohexane
1,1-dipropoxycyclohexane (PubChem CID 22250755) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 1,1-dipropoxycyclohexane.
Molecular Properties
| Compound Name | 1,1-dipropoxycyclohexane |
| PubChem CID | 22250755 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1,1-dipropoxycyclohexane |
| SMILES | CCCOC1(OCCC)CCCCC1 |
| InChI | InChI=1S/C12H24O2/c1-3-10-13-12(14-11-4-2)8-6-5-7-9-12/h3-11H2,1-2H3 |
| InChIKey | IEIYNUJMIWPRGL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dipropoxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dipropoxycyclohexane?
The IUPAC name of 1,1-dipropoxycyclohexane (CID 22250755) is 1,1-dipropoxycyclohexane.
What is the SMILES notation for 1,1-dipropoxycyclohexane?
The canonical SMILES for 1,1-dipropoxycyclohexane is CCCOC1(OCCC)CCCCC1.
What is the InChIKey of 1,1-dipropoxycyclohexane?
The InChIKey is IEIYNUJMIWPRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-3-10-13-12(14-11-4-2)8-6-5-7-9-12/h3-11H2,1-2H3.
What are the key properties of 1,1-dipropoxycyclohexane?
1,1-dipropoxycyclohexane has a molecular weight of 200.32 g/mol, XLogP of 3.50, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dipropoxycyclohexane is sourced from PubChem (CID 22250755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).