About 3,4,4-trimethylcarbazole
3,4,4-trimethylcarbazole (PubChem CID 22250977) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,4,4-trimethylcarbazole.
Molecular Properties
| Compound Name | 3,4,4-trimethylcarbazole |
| PubChem CID | 22250977 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3,4,4-trimethylcarbazole |
| SMILES | CC1=CC=C2N=c3ccccc3=C2C1(C)C |
| InChI | InChI=1S/C15H15N/c1-10-8-9-13-14(15(10,2)3)11-6-4-5-7-12(11)16-13/h4-9H,1-3H3 |
| InChIKey | NJUAZXRLYGBUIW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4,4-trimethylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,4-trimethylcarbazole?
The IUPAC name of 3,4,4-trimethylcarbazole (CID 22250977) is 3,4,4-trimethylcarbazole.
What is the SMILES notation for 3,4,4-trimethylcarbazole?
The canonical SMILES for 3,4,4-trimethylcarbazole is CC1=CC=C2N=c3ccccc3=C2C1(C)C.
What is the InChIKey of 3,4,4-trimethylcarbazole?
The InChIKey is NJUAZXRLYGBUIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-10-8-9-13-14(15(10,2)3)11-6-4-5-7-12(11)16-13/h4-9H,1-3H3.
What are the key properties of 3,4,4-trimethylcarbazole?
3,4,4-trimethylcarbazole has a molecular weight of 209.29 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,4-trimethylcarbazole is sourced from PubChem (CID 22250977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).