C12BaF10O6S2 — CID 22251536
barium(2+);bis(2,3,4,5,6-pentafluorobenzenesulfonate) (PubChem CID 22251536) has the molecular formula C12BaF10O6S2 and a molecular weight of 631.57 g/mol. Its IUPAC name is barium(2+);bis(2,3,4,5,6-pentafluorobenzenesulfonate).
| Compound Name | barium(2+);bis(2,3,4,5,6-pentafluorobenzenesulfonate) |
|---|---|
| PubChem CID | 22251536 |
| Molecular Formula | C12BaF10O6S2 |
| Molecular Weight | 631.57 g/mol |
| Exact Mass | 631.80 |
| IUPAC Name | barium(2+);bis(2,3,4,5,6-pentafluorobenzenesulfonate) |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F.O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F.[Ba+2] |
| InChI | InChI=1S/2C6HF5O3S.Ba/c2*7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9;/h2*(H,12,13,14);/q;;+2/p-2 |
| InChIKey | BLLYNRVBNWQNNM-UHFFFAOYSA-L |
| XLogP | 2.19 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|