About N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide
N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide (PubChem CID 2225156) has the molecular formula C24H20FN3O
and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide |
| PubChem CID | 2225156 |
| Molecular Formula | C24H20FN3O |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1cnn(Cc2ccc(F)cc2)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20FN3O/c25-21-13-11-18(12-14-21)16-28-17-22(15-26-28)27-24(29)23(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-15,17,23H,16H2,(H,27,29) |
| InChIKey | KAPBRJCXRLLTSE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide?
The IUPAC name of N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide (CID 2225156) is N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide.
What is the SMILES notation for N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide?
The canonical SMILES for N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide is O=C(Nc1cnn(Cc2ccc(F)cc2)c1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide?
The InChIKey is KAPBRJCXRLLTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20FN3O/c25-21-13-11-18(12-14-21)16-28-17-22(15-26-28)27-24(29)23(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-15,17,23H,16H2,(H,27,29).
What are the key properties of N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide?
N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide has a molecular weight of 385.44 g/mol, XLogP of 4.84, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2,2-diphenylacetamide is sourced from PubChem (CID 2225156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).