C30H60N2 — CID 22251717
N,N'-bis(2,6-ditert-butylcyclohexyl)ethane-1,2-diamine (PubChem CID 22251717) has the molecular formula C30H60N2 and a molecular weight of 448.82 g/mol. Its IUPAC name is N,N'-bis(2,6-ditert-butylcyclohexyl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(2,6-ditert-butylcyclohexyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 22251717 |
| Molecular Formula | C30H60N2 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.48 |
| IUPAC Name | N,N'-bis(2,6-ditert-butylcyclohexyl)ethane-1,2-diamine |
| SMILES | CC(C)(C)C1CCCC(C(C)(C)C)C1NCCNC1C(C(C)(C)C)CCCC1C(C)(C)C |
| InChI | InChI=1S/C30H60N2/c1-27(2,3)21-15-13-16-22(28(4,5)6)25(21)31-19-20-32-26-23(29(7,8)9)17-14-18-24(26)30(10,11)12/h21-26,31-32H,13-20H2,1-12H3 |
| InChIKey | NPODCRPFAOIEOP-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|