C22H30F6N2Si2 — CID 22251734
N,N'-bis[2-(trifluoromethyl)phenyl]-N,N'-bis(trimethylsilyl)ethane-1,2-diamine (PubChem CID 22251734) has the molecular formula C22H30F6N2Si2 and a molecular weight of 492.66 g/mol. Its IUPAC name is N,N'-bis[2-(trifluoromethyl)phenyl]-N,N'-bis(trimethylsilyl)ethane-1,2-diamine.
| Compound Name | N,N'-bis[2-(trifluoromethyl)phenyl]-N,N'-bis(trimethylsilyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 22251734 |
| Molecular Formula | C22H30F6N2Si2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N,N'-bis[2-(trifluoromethyl)phenyl]-N,N'-bis(trimethylsilyl)ethane-1,2-diamine |
| SMILES | C[Si](C)(C)N(CCN(c1ccccc1C(F)(F)F)[Si](C)(C)C)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H30F6N2Si2/c1-31(2,3)29(19-13-9-7-11-17(19)21(23,24)25)15-16-30(32(4,5)6)20-14-10-8-12-18(20)22(26,27)28/h7-14H,15-16H2,1-6H3 |
| InChIKey | TWIUWFCREYGFQW-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|