About 2-propylheptadecanoic acid
2-propylheptadecanoic acid (PubChem CID 22251985) has the molecular formula C20H40O2
and a molecular weight of 312.54 g/mol. Its IUPAC name is 2-propylheptadecanoic acid.
Molecular Properties
| Compound Name | 2-propylheptadecanoic acid |
| PubChem CID | 22251985 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 2-propylheptadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(CCC)C(=O)O |
| InChI | InChI=1S/C20H40O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-18-19(17-4-2)20(21)22/h19H,3-18H2,1-2H3,(H,21,22) |
| InChIKey | WYCYQIZNCHAQOM-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propylheptadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylheptadecanoic acid?
The IUPAC name of 2-propylheptadecanoic acid (CID 22251985) is 2-propylheptadecanoic acid.
What is the SMILES notation for 2-propylheptadecanoic acid?
The canonical SMILES for 2-propylheptadecanoic acid is CCCCCCCCCCCCCCCC(CCC)C(=O)O.
What is the InChIKey of 2-propylheptadecanoic acid?
The InChIKey is WYCYQIZNCHAQOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-18-19(17-4-2)20(21)22/h19H,3-18H2,1-2H3,(H,21,22).
What are the key properties of 2-propylheptadecanoic acid?
2-propylheptadecanoic acid has a molecular weight of 312.54 g/mol, XLogP of 6.97, 17 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylheptadecanoic acid is sourced from PubChem (CID 22251985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).