C6H11N5 — CID 22252
6-propyl-1,3,5-triazine-2,4-diamine (PubChem CID 22252) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is 6-propyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-propyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22252 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 6-propyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C6H11N5/c1-2-3-4-9-5(7)11-6(8)10-4/h2-3H2,1H3,(H4,7,8,9,10,11) |
| InChIKey | NGYGUYRBWLUDRP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |