C30H54N2OSn — CID 22252300
[4-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)butoxy]phenyl]-tributylstannane (PubChem CID 22252300) has the molecular formula C30H54N2OSn and a molecular weight of 577.49 g/mol. Its IUPAC name is [4-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)butoxy]phenyl]-tributylstannane.
| Compound Name | [4-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)butoxy]phenyl]-tributylstannane |
|---|---|
| PubChem CID | 22252300 |
| Molecular Formula | C30H54N2OSn |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | [4-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)butoxy]phenyl]-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(OCCCCN2CCN3CCCCC3C2)cc1 |
| InChI | InChI=1S/C18H27N2O.3C4H9.Sn/c1-2-9-18(10-3-1)21-15-7-6-11-19-13-14-20-12-5-4-8-17(20)16-19;3*1-3-4-2;/h2-3,9-10,17H,4-8,11-16H2;3*1,3-4H2,2H3; |
| InChIKey | PDAKCDFYYMNLBL-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|