C24H29NO5Se — CID 22252722
6-[[3-(3-carboxypropoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]pyridine-3-carboxylic acid (PubChem CID 22252722) has the molecular formula C24H29NO5Se and a molecular weight of 490.46 g/mol. Its IUPAC name is 6-[[3-(3-carboxypropoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[[3-(3-carboxypropoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 22252722 |
| Molecular Formula | C24H29NO5Se |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 6-[[3-(3-carboxypropoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]pyridine-3-carboxylic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc([Se]c3ccc(C(=O)O)cn3)c(OCCCC(=O)O)cc21 |
| InChI | InChI=1S/C24H29NO5Se/c1-23(2)9-10-24(3,4)17-13-19(31-20-8-7-15(14-25-20)22(28)29)18(12-16(17)23)30-11-5-6-21(26)27/h7-8,12-14H,5-6,9-11H2,1-4H3,(H,26,27)(H,28,29) |
| InChIKey | UFFKVYCHKZZOFL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|