C33H51NO4SeSi — CID 22252742
ethyl 6-[[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]pyridine-3-carboxylate (PubChem CID 22252742) has the molecular formula C33H51NO4SeSi and a molecular weight of 632.82 g/mol. Its IUPAC name is ethyl 6-[[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 22252742 |
| Molecular Formula | C33H51NO4SeSi |
| Molecular Weight | 632.82 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | ethyl 6-[[3-[5-[tert-butyl(dimethyl)silyl]oxypentoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]selanyl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc([Se]c2cc3c(cc2OCCCCCO[Si](C)(C)C(C)(C)C)C(C)(C)CCC3(C)C)nc1 |
| InChI | InChI=1S/C33H51NO4SeSi/c1-11-36-30(35)24-15-16-29(34-23-24)39-28-22-26-25(32(5,6)17-18-33(26,7)8)21-27(28)37-19-13-12-14-20-38-40(9,10)31(2,3)4/h15-16,21-23H,11-14,17-20H2,1-10H3 |
| InChIKey | DMYASLZDJAFASM-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.82 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|