About 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol
2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 22252946) has the molecular formula C10H11BrO
and a molecular weight of 227.10 g/mol. Its IUPAC name is 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol.
Molecular Properties
| Compound Name | 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol |
| PubChem CID | 22252946 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | Oc1c(Br)ccc2c1CCCC2 |
| InChI | InChI=1S/C10H11BrO/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h5-6,12H,1-4H2 |
| InChIKey | UMEVWYIMNWFRAF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol?
The IUPAC name of 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol (CID 22252946) is 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol.
What is the SMILES notation for 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol?
The canonical SMILES for 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol is Oc1c(Br)ccc2c1CCCC2.
What is the InChIKey of 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol?
The InChIKey is UMEVWYIMNWFRAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h5-6,12H,1-4H2.
What are the key properties of 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol?
2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol has a molecular weight of 227.10 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5,6,7,8-tetrahydronaphthalen-1-ol is sourced from PubChem (CID 22252946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).