C12H23NO5Si — CID 22252969
3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylic acid (PubChem CID 22252969) has the molecular formula C12H23NO5Si and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 22252969 |
| Molecular Formula | C12H23NO5Si |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCN(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C12H23NO5Si/c1-12(2,3)19(4,5)18-8-6-7-13(11(16)17)9(8)10(14)15/h8-9H,6-7H2,1-5H3,(H,14,15)(H,16,17) |
| InChIKey | PLADLMFPOTXWSK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|