C42H46MgSi — CID 22253520
magnesium bis[7-(4-tert-butylphenyl)-2-methyl-3H-inden-3-id-1-yl]-dimethylsilane (PubChem CID 22253520) has the molecular formula C42H46MgSi and a molecular weight of 603.22 g/mol. Its IUPAC name is magnesium bis[7-(4-tert-butylphenyl)-2-methyl-3H-inden-3-id-1-yl]-dimethylsilane.
| Compound Name | magnesium bis[7-(4-tert-butylphenyl)-2-methyl-3H-inden-3-id-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 22253520 |
| Molecular Formula | C42H46MgSi |
| Molecular Weight | 603.22 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | magnesium bis[7-(4-tert-butylphenyl)-2-methyl-3H-inden-3-id-1-yl]-dimethylsilane |
| SMILES | Cc1[cH-]c2cccc(-c3ccc(C(C)(C)C)cc3)c2c1[Si](C)(C)c1c(C)[cH-]c2cccc(-c3ccc(C(C)(C)C)cc3)c12.[Mg+2] |
| InChI | InChI=1S/C42H46Si.Mg/c1-27-25-31-13-11-15-35(29-17-21-33(22-18-29)41(3,4)5)37(31)39(27)43(9,10)40-28(2)26-32-14-12-16-36(38(32)40)30-19-23-34(24-20-30)42(6,7)8;/h11-26H,1-10H3;/q-2;+2 |
| InChIKey | WPIHIIDFJFFNIA-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.22 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|