About azanium;ethene;perchlorate
azanium;ethene;perchlorate (PubChem CID 22253710) has the molecular formula C2H8ClNO4
and a molecular weight of 145.54 g/mol. Its IUPAC name is azanium;ethene;perchlorate.
Molecular Properties
| Compound Name | azanium;ethene;perchlorate |
| PubChem CID | 22253710 |
| Molecular Formula | C2H8ClNO4 |
| Molecular Weight | 145.54 g/mol |
| Exact Mass | 145.01 |
| IUPAC Name | azanium;ethene;perchlorate |
| SMILES | C=C.[NH4+].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C2H4.ClHO4.H3N/c1-2;2-1(3,4)5;/h1-2H2;(H,2,3,4,5);1H3 |
| InChIKey | XLWXQCOFLCXPDC-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.54 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azanium;ethene;perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;ethene;perchlorate?
The IUPAC name of azanium;ethene;perchlorate (CID 22253710) is azanium;ethene;perchlorate.
What is the SMILES notation for azanium;ethene;perchlorate?
The canonical SMILES for azanium;ethene;perchlorate is C=C.[NH4+].[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of azanium;ethene;perchlorate?
The InChIKey is XLWXQCOFLCXPDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4.ClHO4.H3N/c1-2;2-1(3,4)5;/h1-2H2;(H,2,3,4,5);1H3.
What are the key properties of azanium;ethene;perchlorate?
azanium;ethene;perchlorate has a molecular weight of 145.54 g/mol, XLogP of -3.58, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;ethene;perchlorate is sourced from PubChem (CID 22253710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).