About 4-(disulfanyl)aniline
4-(disulfanyl)aniline (PubChem CID 22253772) has the molecular formula C6H7NS2
and a molecular weight of 157.26 g/mol. Its IUPAC name is 4-(disulfanyl)aniline.
Molecular Properties
| Compound Name | 4-(disulfanyl)aniline |
| PubChem CID | 22253772 |
| Molecular Formula | C6H7NS2 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.00 |
| IUPAC Name | 4-(disulfanyl)aniline |
| SMILES | Nc1ccc(SS)cc1 |
| InChI | InChI=1S/C6H7NS2/c7-5-1-3-6(9-8)4-2-5/h1-4,8H,7H2 |
| InChIKey | GCOZEKGOVFIGQW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(disulfanyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(disulfanyl)aniline?
The IUPAC name of 4-(disulfanyl)aniline (CID 22253772) is 4-(disulfanyl)aniline.
What is the SMILES notation for 4-(disulfanyl)aniline?
The canonical SMILES for 4-(disulfanyl)aniline is Nc1ccc(SS)cc1.
What is the InChIKey of 4-(disulfanyl)aniline?
The InChIKey is GCOZEKGOVFIGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NS2/c7-5-1-3-6(9-8)4-2-5/h1-4,8H,7H2.
What are the key properties of 4-(disulfanyl)aniline?
4-(disulfanyl)aniline has a molecular weight of 157.26 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(disulfanyl)aniline is sourced from PubChem (CID 22253772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).