C9H10F9N — CID 22253782
2,2,3,3,4,4,5,6,6-nonafluoro-5-methyl-1-propylpiperidine (PubChem CID 22253782) has the molecular formula C9H10F9N and a molecular weight of 303.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,6,6-nonafluoro-5-methyl-1-propylpiperidine.
| Compound Name | 2,2,3,3,4,4,5,6,6-nonafluoro-5-methyl-1-propylpiperidine |
|---|---|
| PubChem CID | 22253782 |
| Molecular Formula | C9H10F9N |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2,2,3,3,4,4,5,6,6-nonafluoro-5-methyl-1-propylpiperidine |
| SMILES | CCCN1C(F)(F)C(C)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H10F9N/c1-3-4-19-8(15,16)5(2,10)6(11,12)7(13,14)9(19,17)18/h3-4H2,1-2H3 |
| InChIKey | ISHZCDGZUXXTAK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|