About 2-(1,1,2-triethoxypropyl)butanedioic acid
2-(1,1,2-triethoxypropyl)butanedioic acid (PubChem CID 22253884) has the molecular formula C13H24O7
and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-(1,1,2-triethoxypropyl)butanedioic acid.
Molecular Properties
| Compound Name | 2-(1,1,2-triethoxypropyl)butanedioic acid |
| PubChem CID | 22253884 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-(1,1,2-triethoxypropyl)butanedioic acid |
| SMILES | CCOC(C)C(OCC)(OCC)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H24O7/c1-5-18-9(4)13(19-6-2,20-7-3)10(12(16)17)8-11(14)15/h9-10H,5-8H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | VYCWQPMJFZBBRI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1,2-triethoxypropyl)butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1,2-triethoxypropyl)butanedioic acid?
The IUPAC name of 2-(1,1,2-triethoxypropyl)butanedioic acid (CID 22253884) is 2-(1,1,2-triethoxypropyl)butanedioic acid.
What is the SMILES notation for 2-(1,1,2-triethoxypropyl)butanedioic acid?
The canonical SMILES for 2-(1,1,2-triethoxypropyl)butanedioic acid is CCOC(C)C(OCC)(OCC)C(CC(=O)O)C(=O)O.
What is the InChIKey of 2-(1,1,2-triethoxypropyl)butanedioic acid?
The InChIKey is VYCWQPMJFZBBRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O7/c1-5-18-9(4)13(19-6-2,20-7-3)10(12(16)17)8-11(14)15/h9-10H,5-8H2,1-4H3,(H,14,15)(H,16,17).
What are the key properties of 2-(1,1,2-triethoxypropyl)butanedioic acid?
2-(1,1,2-triethoxypropyl)butanedioic acid has a molecular weight of 292.33 g/mol, XLogP of 1.36, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1,2-triethoxypropyl)butanedioic acid is sourced from PubChem (CID 22253884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).