C18H25N3O2S3 — CID 22253974
N-[5-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)pentyl]ethanesulfonamide (PubChem CID 22253974) has the molecular formula C18H25N3O2S3 and a molecular weight of 411.62 g/mol. Its IUPAC name is N-[5-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)pentyl]ethanesulfonamide.
| Compound Name | N-[5-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)pentyl]ethanesulfonamide |
|---|---|
| PubChem CID | 22253974 |
| Molecular Formula | C18H25N3O2S3 |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[5-(4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-ylamino)pentyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCCCCNc1nc2c(s1)CCSc1ccccc1-2 |
| InChI | InChI=1S/C18H25N3O2S3/c1-2-26(22,23)20-12-7-3-6-11-19-18-21-17-14-8-4-5-9-15(14)24-13-10-16(17)25-18/h4-5,8-9,20H,2-3,6-7,10-13H2,1H3,(H,19,21) |
| InChIKey | WENDLSLEOSIVLM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|