C17H22FN3O2S3 — CID 22254110
N-[5-[(9-fluoro-4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-yl)amino]pentyl]methanesulfonamide (PubChem CID 22254110) has the molecular formula C17H22FN3O2S3 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[5-[(9-fluoro-4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-yl)amino]pentyl]methanesulfonamide.
| Compound Name | N-[5-[(9-fluoro-4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-yl)amino]pentyl]methanesulfonamide |
|---|---|
| PubChem CID | 22254110 |
| Molecular Formula | C17H22FN3O2S3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[5-[(9-fluoro-4,5-dihydro-[1]benzothiepino[5,4-d][1,3]thiazol-2-yl)amino]pentyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCCCNc1nc2c(s1)CCSc1ccc(F)cc1-2 |
| InChI | InChI=1S/C17H22FN3O2S3/c1-26(22,23)20-9-4-2-3-8-19-17-21-16-13-11-12(18)5-6-14(13)24-10-7-15(16)25-17/h5-6,11,20H,2-4,7-10H2,1H3,(H,19,21) |
| InChIKey | OQBZFIIYCJNPGI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|