About 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate
2-imidazo[4,5-c]quinolin-1-ylbutyl acetate (PubChem CID 22254426) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate.
Molecular Properties
| Compound Name | 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate |
| PubChem CID | 22254426 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate |
| SMILES | CCC(COC(C)=O)n1cnc2cnc3ccccc3c21 |
| InChI | InChI=1S/C16H17N3O2/c1-3-12(9-21-11(2)20)19-10-18-15-8-17-14-7-5-4-6-13(14)16(15)19/h4-8,10,12H,3,9H2,1-2H3 |
| InChIKey | PKVMMGWDABXLLX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate?
The IUPAC name of 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate (CID 22254426) is 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate.
What is the SMILES notation for 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate?
The canonical SMILES for 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate is CCC(COC(C)=O)n1cnc2cnc3ccccc3c21.
What is the InChIKey of 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate?
The InChIKey is PKVMMGWDABXLLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c1-3-12(9-21-11(2)20)19-10-18-15-8-17-14-7-5-4-6-13(14)16(15)19/h4-8,10,12H,3,9H2,1-2H3.
What are the key properties of 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate?
2-imidazo[4,5-c]quinolin-1-ylbutyl acetate has a molecular weight of 283.33 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[4,5-c]quinolin-1-ylbutyl acetate is sourced from PubChem (CID 22254426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).