About tetrazolo[1,5-a]quinoline-4,5-diamine
tetrazolo[1,5-a]quinoline-4,5-diamine (PubChem CID 22254489) has the molecular formula C9H8N6
and a molecular weight of 200.21 g/mol. Its IUPAC name is tetrazolo[1,5-a]quinoline-4,5-diamine.
Molecular Properties
| Compound Name | tetrazolo[1,5-a]quinoline-4,5-diamine |
| PubChem CID | 22254489 |
| Molecular Formula | C9H8N6 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | tetrazolo[1,5-a]quinoline-4,5-diamine |
| SMILES | Nc1c(N)c2nnnn2c2ccccc12 |
| InChI | InChI=1S/C9H8N6/c10-7-5-3-1-2-4-6(5)15-9(8(7)11)12-13-14-15/h1-4H,10-11H2 |
| InChIKey | KDXKKSGAKJPGNY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tetrazolo[1,5-a]quinoline-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrazolo[1,5-a]quinoline-4,5-diamine?
The IUPAC name of tetrazolo[1,5-a]quinoline-4,5-diamine (CID 22254489) is tetrazolo[1,5-a]quinoline-4,5-diamine.
What is the SMILES notation for tetrazolo[1,5-a]quinoline-4,5-diamine?
The canonical SMILES for tetrazolo[1,5-a]quinoline-4,5-diamine is Nc1c(N)c2nnnn2c2ccccc12.
What is the InChIKey of tetrazolo[1,5-a]quinoline-4,5-diamine?
The InChIKey is KDXKKSGAKJPGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6/c10-7-5-3-1-2-4-6(5)15-9(8(7)11)12-13-14-15/h1-4H,10-11H2.
What are the key properties of tetrazolo[1,5-a]quinoline-4,5-diamine?
tetrazolo[1,5-a]quinoline-4,5-diamine has a molecular weight of 200.21 g/mol, XLogP of 0.44, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tetrazolo[1,5-a]quinoline-4,5-diamine is sourced from PubChem (CID 22254489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).