C26H25FN6O2S — CID 22254808
1-[[2-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-5-methyl-1,3-dioxan-5-yl]methyl]-3-pyridin-3-ylthiourea (PubChem CID 22254808) has the molecular formula C26H25FN6O2S and a molecular weight of 504.59 g/mol. Its IUPAC name is 1-[[2-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-5-methyl-1,3-dioxan-5-yl]methyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[[2-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-5-methyl-1,3-dioxan-5-yl]methyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 22254808 |
| Molecular Formula | C26H25FN6O2S |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 1-[[2-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-5-methyl-1,3-dioxan-5-yl]methyl]-3-pyridin-3-ylthiourea |
| SMILES | CC1(CNC(=S)Nc2cccnc2)COC(c2nc(-c3ccc(F)cc3)c(-c3ccncc3)[nH]2)OC1 |
| InChI | InChI=1S/C26H25FN6O2S/c1-26(14-30-25(36)31-20-3-2-10-29-13-20)15-34-24(35-16-26)23-32-21(17-4-6-19(27)7-5-17)22(33-23)18-8-11-28-12-9-18/h2-13,24H,14-16H2,1H3,(H,32,33)(H2,30,31,36) |
| InChIKey | KGBVSKGDOCJGCO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|