About N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide
N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide (PubChem CID 2225580) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide |
| PubChem CID | 2225580 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H14N2O4/c19-15(16(20)18-12-4-2-1-3-5-12)17-9-11-6-7-13-14(8-11)22-10-21-13/h1-8H,9-10H2,(H,17,19)(H,18,20) |
| InChIKey | WIGBTGGMBHQHCD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide?
The IUPAC name of N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide (CID 2225580) is N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide.
What is the SMILES notation for N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide?
The canonical SMILES for N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide is O=C(NCc1ccc2c(c1)OCO2)C(=O)Nc1ccccc1.
What is the InChIKey of N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide?
The InChIKey is WIGBTGGMBHQHCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4/c19-15(16(20)18-12-4-2-1-3-5-12)17-9-11-6-7-13-14(8-11)22-10-21-13/h1-8H,9-10H2,(H,17,19)(H,18,20).
What are the key properties of N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide?
N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide has a molecular weight of 298.30 g/mol, XLogP of 1.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzodioxol-5-ylmethyl)-N'-phenyloxamide is sourced from PubChem (CID 2225580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).