C16H33ClN2O2 — CID 22255945
1-[butyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-3-chloropropan-2-ol (PubChem CID 22255945) has the molecular formula C16H33ClN2O2 and a molecular weight of 320.91 g/mol. Its IUPAC name is 1-[butyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-3-chloropropan-2-ol.
| Compound Name | 1-[butyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-3-chloropropan-2-ol |
|---|---|
| PubChem CID | 22255945 |
| Molecular Formula | C16H33ClN2O2 |
| Molecular Weight | 320.91 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-[butyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-3-chloropropan-2-ol |
| SMILES | CCCCN(CC(O)CCl)C1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C16H33ClN2O2/c1-6-7-8-18(12-14(20)11-17)13-9-15(2,3)19(21)16(4,5)10-13/h13-14,20-21H,6-12H2,1-5H3 |
| InChIKey | IZKIVIZNTWCWFX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|