About bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine
bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine (PubChem CID 22256298) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine |
| PubChem CID | 22256298 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine |
| SMILES | CCN.c1cc2ccc1-2 |
| InChI | InChI=1S/C6H4.C2H7N/c1-2-6-4-3-5(1)6;1-2-3/h1-4H;2-3H2,1H3 |
| InChIKey | ZTQGFWJXYFYVOS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine (CID 22256298) is bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine is CCN.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine?
The InChIKey is ZTQGFWJXYFYVOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.C2H7N/c1-2-6-4-3-5(1)6;1-2-3/h1-4H;2-3H2,1H3.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine?
bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine has a molecular weight of 121.18 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;ethanamine is sourced from PubChem (CID 22256298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).