C22H12Cl2N4OS — CID 22256640
7-(2,4-dichloro-5-methoxyanilino)-2-(2-pyridin-2-ylethynyl)thieno[3,2-b]pyridine-6-carbonitrile (PubChem CID 22256640) has the molecular formula C22H12Cl2N4OS and a molecular weight of 451.34 g/mol. Its IUPAC name is 7-(2,4-dichloro-5-methoxyanilino)-2-(2-pyridin-2-ylethynyl)thieno[3,2-b]pyridine-6-carbonitrile.
| Compound Name | 7-(2,4-dichloro-5-methoxyanilino)-2-(2-pyridin-2-ylethynyl)thieno[3,2-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 22256640 |
| Molecular Formula | C22H12Cl2N4OS |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | 7-(2,4-dichloro-5-methoxyanilino)-2-(2-pyridin-2-ylethynyl)thieno[3,2-b]pyridine-6-carbonitrile |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(C#Cc4ccccn4)sc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H12Cl2N4OS/c1-29-20-10-18(16(23)9-17(20)24)28-21-13(11-25)12-27-19-8-15(30-22(19)21)6-5-14-4-2-3-7-26-14/h2-4,7-10,12H,1H3,(H,27,28) |
| InChIKey | DKRUPSCJXDJCRS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|