C19H20NO3- — CID 22256684
4-methyl-4-(2-phenoxyphenyl)piperidine-1-carboxylate (PubChem CID 22256684) has the molecular formula C19H20NO3- and a molecular weight of 310.37 g/mol. Its IUPAC name is 4-methyl-4-(2-phenoxyphenyl)piperidine-1-carboxylate.
| Compound Name | 4-methyl-4-(2-phenoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22256684 |
| Molecular Formula | C19H20NO3- |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-methyl-4-(2-phenoxyphenyl)piperidine-1-carboxylate |
| SMILES | CC1(c2ccccc2Oc2ccccc2)CCN(C(=O)[O-])CC1 |
| InChI | InChI=1S/C19H21NO3/c1-19(11-13-20(14-12-19)18(21)22)16-9-5-6-10-17(16)23-15-7-3-2-4-8-15/h2-10H,11-14H2,1H3,(H,21,22)/p-1 |
| InChIKey | WBRUIZFYWURWPZ-UHFFFAOYSA-M |
| XLogP | 3.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |