About 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide (PubChem CID 2225699) has the molecular formula C14H17N3O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide |
| PubChem CID | 2225699 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C14H17N3O4/c1-14(2)12(19)17(13(20)16-14)8-11(18)15-9-6-4-5-7-10(9)21-3/h4-7H,8H2,1-3H3,(H,15,18)(H,16,20) |
| InChIKey | JXKRVKIOCVUKSK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide?
The IUPAC name of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide (CID 2225699) is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide.
What is the SMILES notation for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide?
The canonical SMILES for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide is COc1ccccc1NC(=O)CN1C(=O)NC(C)(C)C1=O.
What is the InChIKey of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide?
The InChIKey is JXKRVKIOCVUKSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O4/c1-14(2)12(19)17(13(20)16-14)8-11(18)15-9-6-4-5-7-10(9)21-3/h4-7H,8H2,1-3H3,(H,15,18)(H,16,20).
What are the key properties of 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide?
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide has a molecular weight of 291.31 g/mol, XLogP of 0.96, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-(2-methoxyphenyl)acetamide is sourced from PubChem (CID 2225699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).