About 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid
1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid (PubChem CID 22257140) has the molecular formula C12H16N6O7S
and a molecular weight of 388.36 g/mol. Its IUPAC name is 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid |
| PubChem CID | 22257140 |
| Molecular Formula | C12H16N6O7S |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)N2C=C(C(=O)O)CN2C)n1 |
| InChI | InChI=1S/C12H16N6O7S/c1-17-5-7(10(19)20)6-18(17)26(22,23)16-12(21)15-11-13-8(24-2)4-9(14-11)25-3/h4,6H,5H2,1-3H3,(H,19,20)(H2,13,14,15,16,21) |
| InChIKey | KVKKMFNVUPTADC-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid?
The IUPAC name of 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid (CID 22257140) is 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid?
The canonical SMILES for 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid is COc1cc(OC)nc(NC(=O)NS(=O)(=O)N2C=C(C(=O)O)CN2C)n1.
What is the InChIKey of 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid?
The InChIKey is KVKKMFNVUPTADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N6O7S/c1-17-5-7(10(19)20)6-18(17)26(22,23)16-12(21)15-11-13-8(24-2)4-9(14-11)25-3/h4,6H,5H2,1-3H3,(H,19,20)(H2,13,14,15,16,21).
What are the key properties of 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid?
1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid has a molecular weight of 388.36 g/mol, XLogP of -1.01, 6 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-2-methyl-3H-pyrazole-4-carboxylic acid is sourced from PubChem (CID 22257140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).