C12H10O6S — CID 22257584
4-(2,3,4-trihydroxyphenyl)sulfanylbenzene-1,2,3-triol (PubChem CID 22257584) has the molecular formula C12H10O6S and a molecular weight of 282.27 g/mol. Its IUPAC name is 4-(2,3,4-trihydroxyphenyl)sulfanylbenzene-1,2,3-triol.
| Compound Name | 4-(2,3,4-trihydroxyphenyl)sulfanylbenzene-1,2,3-triol |
|---|---|
| PubChem CID | 22257584 |
| Molecular Formula | C12H10O6S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 4-(2,3,4-trihydroxyphenyl)sulfanylbenzene-1,2,3-triol |
| SMILES | Oc1ccc(Sc2ccc(O)c(O)c2O)c(O)c1O |
| InChI | InChI=1S/C12H10O6S/c13-5-1-3-7(11(17)9(5)15)19-8-4-2-6(14)10(16)12(8)18/h1-4,13-18H |
| InChIKey | YAAOEYDWXYBKOC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|