About 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione
3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione (PubChem CID 22257788) has the molecular formula C16H25NO3
and a molecular weight of 279.38 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione |
| PubChem CID | 22257788 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione |
| SMILES | C=CCCC(=O)C1CCCN1C(=O)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C16H25NO3/c1-5-7-10-13(18)12-9-8-11-17(12)15(20)14(19)16(3,4)6-2/h5,12H,1,6-11H2,2-4H3 |
| InChIKey | HOGNEZXIOZGORR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione?
The IUPAC name of 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione (CID 22257788) is 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione.
What is the SMILES notation for 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione?
The canonical SMILES for 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione is C=CCCC(=O)C1CCCN1C(=O)C(=O)C(C)(C)CC.
What is the InChIKey of 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione?
The InChIKey is HOGNEZXIOZGORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO3/c1-5-7-10-13(18)12-9-8-11-17(12)15(20)14(19)16(3,4)6-2/h5,12H,1,6-11H2,2-4H3.
What are the key properties of 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione?
3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione has a molecular weight of 279.38 g/mol, XLogP of 2.52, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-(2-pent-4-enoylpyrrolidin-1-yl)pentane-1,2-dione is sourced from PubChem (CID 22257788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).