About 3-methylindole-2-thione
3-methylindole-2-thione (PubChem CID 22257834) has the molecular formula C9H7NS
and a molecular weight of 161.23 g/mol. Its IUPAC name is 3-methylindole-2-thione.
Molecular Properties
| Compound Name | 3-methylindole-2-thione |
| PubChem CID | 22257834 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 3-methylindole-2-thione |
| SMILES | CC1=c2ccccc2=NC1=S |
| InChI | InChI=1S/C9H7NS/c1-6-7-4-2-3-5-8(7)10-9(6)11/h2-5H,1H3 |
| InChIKey | SHLNUMYGGIIYJP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methylindole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylindole-2-thione?
The IUPAC name of 3-methylindole-2-thione (CID 22257834) is 3-methylindole-2-thione.
What is the SMILES notation for 3-methylindole-2-thione?
The canonical SMILES for 3-methylindole-2-thione is CC1=c2ccccc2=NC1=S.
What is the InChIKey of 3-methylindole-2-thione?
The InChIKey is SHLNUMYGGIIYJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS/c1-6-7-4-2-3-5-8(7)10-9(6)11/h2-5H,1H3.
What are the key properties of 3-methylindole-2-thione?
3-methylindole-2-thione has a molecular weight of 161.23 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylindole-2-thione is sourced from PubChem (CID 22257834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).