About 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide
2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide (PubChem CID 2225831) has the molecular formula C12H18N2O4S
and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide |
| PubChem CID | 2225831 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide |
| SMILES | COCCNC(=O)c1ccc(C(=O)NCCOC)s1 |
| InChI | InChI=1S/C12H18N2O4S/c1-17-7-5-13-11(15)9-3-4-10(19-9)12(16)14-6-8-18-2/h3-4H,5-8H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | ZSRUYTSQCDWQMB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide?
The IUPAC name of 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide (CID 2225831) is 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide.
What is the SMILES notation for 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide?
The canonical SMILES for 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide is COCCNC(=O)c1ccc(C(=O)NCCOC)s1.
What is the InChIKey of 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide?
The InChIKey is ZSRUYTSQCDWQMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4S/c1-17-7-5-13-11(15)9-3-4-10(19-9)12(16)14-6-8-18-2/h3-4H,5-8H2,1-2H3,(H,13,15)(H,14,16).
What are the key properties of 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide?
2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide has a molecular weight of 286.35 g/mol, XLogP of 0.50, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-N-bis(2-methoxyethyl)thiophene-2,5-dicarboxamide is sourced from PubChem (CID 2225831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).