C28H27F3N4O5 — CID 22258432
N-[2-(hydroxycarbamoyl)cyclopentyl]-1-[(2-methylquinolin-4-yl)methyl]indole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 22258432) has the molecular formula C28H27F3N4O5 and a molecular weight of 556.54 g/mol. Its IUPAC name is N-[2-(hydroxycarbamoyl)cyclopentyl]-1-[(2-methylquinolin-4-yl)methyl]indole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(hydroxycarbamoyl)cyclopentyl]-1-[(2-methylquinolin-4-yl)methyl]indole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22258432 |
| Molecular Formula | C28H27F3N4O5 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | N-[2-(hydroxycarbamoyl)cyclopentyl]-1-[(2-methylquinolin-4-yl)methyl]indole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(Cn2ccc3c(C(=O)NC4CCCC4C(=O)NO)cccc32)c2ccccc2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H26N4O3.C2HF3O2/c1-16-14-17(18-6-2-3-9-22(18)27-16)15-30-13-12-19-20(7-5-11-24(19)30)25(31)28-23-10-4-8-21(23)26(32)29-33;3-2(4,5)1(6)7/h2-3,5-7,9,11-14,21,23,33H,4,8,10,15H2,1H3,(H,28,31)(H,29,32);(H,6,7) |
| InChIKey | XPLDBXLNFJSSCO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|