C32H30F6N4O8 — CID 22258496
N-hydroxy-3-[[6-[(2-methylquinolin-4-yl)methoxy]naphthalene-1-carbonyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 22258496) has the molecular formula C32H30F6N4O8 and a molecular weight of 712.60 g/mol. Its IUPAC name is N-hydroxy-3-[[6-[(2-methylquinolin-4-yl)methoxy]naphthalene-1-carbonyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-hydroxy-3-[[6-[(2-methylquinolin-4-yl)methoxy]naphthalene-1-carbonyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 22258496 |
| Molecular Formula | C32H30F6N4O8 |
| Molecular Weight | 712.60 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | N-hydroxy-3-[[6-[(2-methylquinolin-4-yl)methoxy]naphthalene-1-carbonyl]amino]piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1cc(COc2ccc3c(C(=O)NC4CNCCC4C(=O)NO)cccc3c2)c2ccccc2n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H28N4O4.2C2HF3O2/c1-17-13-19(22-6-2-3-8-25(22)30-17)16-36-20-9-10-21-18(14-20)5-4-7-23(21)27(33)31-26-15-29-12-11-24(26)28(34)32-35;2*3-2(4,5)1(6)7/h2-10,13-14,24,26,29,35H,11-12,15-16H2,1H3,(H,31,33)(H,32,34);2*(H,6,7) |
| InChIKey | BADABBOYRLDYPJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|