C9H16N2 — CID 22258625
1,2,3,5a,6,7,8,9-octahydropyrido[1,2-b]diazepine (PubChem CID 22258625) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,2,3,5a,6,7,8,9-octahydropyrido[1,2-b]diazepine.
| Compound Name | 1,2,3,5a,6,7,8,9-octahydropyrido[1,2-b]diazepine |
|---|---|
| PubChem CID | 22258625 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,2,3,5a,6,7,8,9-octahydropyrido[1,2-b]diazepine |
| SMILES | C1=CC2CCCCN2NCC1 |
| InChI | InChI=1S/C9H16N2/c1-3-7-10-11-8-4-2-6-9(11)5-1/h1,5,9-10H,2-4,6-8H2 |
| InChIKey | MGUQYZSKPMBDBI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|