About 4-methylideneindene
4-methylideneindene (PubChem CID 22259544) has the molecular formula C10H8
and a molecular weight of 128.17 g/mol. Its IUPAC name is 4-methylideneindene.
Molecular Properties
| Compound Name | 4-methylideneindene |
| PubChem CID | 22259544 |
| Molecular Formula | C10H8 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 4-methylideneindene |
| SMILES | C=c1cccc2c1=CC=C2 |
| InChI | InChI=1S/C10H8/c1-8-4-2-5-9-6-3-7-10(8)9/h2-7H,1H2 |
| InChIKey | NIALSTCAZSAUFO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-methylideneindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylideneindene?
The IUPAC name of 4-methylideneindene (CID 22259544) is 4-methylideneindene.
What is the SMILES notation for 4-methylideneindene?
The canonical SMILES for 4-methylideneindene is C=c1cccc2c1=CC=C2.
What is the InChIKey of 4-methylideneindene?
The InChIKey is NIALSTCAZSAUFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8/c1-8-4-2-5-9-6-3-7-10(8)9/h2-7H,1H2.
What are the key properties of 4-methylideneindene?
4-methylideneindene has a molecular weight of 128.17 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylideneindene is sourced from PubChem (CID 22259544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).