About CID 22259720
CID 22259720 (PubChem CID 22259720) has the molecular formula C18H26Si
and a molecular weight of 270.49 g/mol.
Molecular Properties
| Compound Name | CID 22259720 |
| PubChem CID | 22259720 |
| Molecular Formula | C18H26Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | — |
| SMILES | CC1=CC(C)(C)C([Si]C2=C(C)C(C)=CC2(C)C)=C1C |
| InChI | InChI=1S/C18H26Si/c1-11-9-17(5,6)15(13(11)3)19-16-14(4)12(2)10-18(16,7)8/h9-10H,1-8H3 |
| InChIKey | DVVOMGCALCKPAU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22259720 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22259720?
The IUPAC name of CID 22259720 (CID 22259720) is not available.
What is the SMILES notation for CID 22259720?
The canonical SMILES for CID 22259720 is CC1=CC(C)(C)C([Si]C2=C(C)C(C)=CC2(C)C)=C1C.
What is the InChIKey of CID 22259720?
The InChIKey is DVVOMGCALCKPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26Si/c1-11-9-17(5,6)15(13(11)3)19-16-14(4)12(2)10-18(16,7)8/h9-10H,1-8H3.
What are the key properties of CID 22259720?
CID 22259720 has a molecular weight of 270.49 g/mol, XLogP of 5.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22259720 is sourced from PubChem (CID 22259720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).