2-acetyloxyprop-2-enoic acid

C5H6O4 — CID 22259828

IUPAC2-acetyloxyprop-2-enoic acid
SMILESC=C(OC(C)=O)C(=O)O
InChIInChI=1S/C5H6O4/c1-3(5(7)8)9-4(2)6/h1H2,2H3,(H,7,8)
InChIKeyCFVZILWIXKITDD-UHFFFAOYSA-N
MW130.10 g/mol
LogP0.15
Rot. Bonds2

About 2-acetyloxyprop-2-enoic acid

2-acetyloxyprop-2-enoic acid (PubChem CID 22259828) has the molecular formula C5H6O4 and a molecular weight of 130.10 g/mol. Its IUPAC name is 2-acetyloxyprop-2-enoic acid.

Molecular Properties

Compound Name2-acetyloxyprop-2-enoic acid
PubChem CID22259828
Molecular FormulaC5H6O4
Molecular Weight130.10 g/mol
Exact Mass130.03
IUPAC Name2-acetyloxyprop-2-enoic acid
SMILESC=C(OC(C)=O)C(=O)O
InChIInChI=1S/C5H6O4/c1-3(5(7)8)9-4(2)6/h1H2,2H3,(H,7,8)
InChIKeyCFVZILWIXKITDD-UHFFFAOYSA-N
XLogP0.15
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.10
LogP ≤ 50.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-acetyloxyprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyloxyprop-2-enoic acid?
The IUPAC name of 2-acetyloxyprop-2-enoic acid (CID 22259828) is 2-acetyloxyprop-2-enoic acid.
What is the SMILES notation for 2-acetyloxyprop-2-enoic acid?
The canonical SMILES for 2-acetyloxyprop-2-enoic acid is C=C(OC(C)=O)C(=O)O.
What is the InChIKey of 2-acetyloxyprop-2-enoic acid?
The InChIKey is CFVZILWIXKITDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4/c1-3(5(7)8)9-4(2)6/h1H2,2H3,(H,7,8).
What are the key properties of 2-acetyloxyprop-2-enoic acid?
2-acetyloxyprop-2-enoic acid has a molecular weight of 130.10 g/mol, XLogP of 0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyprop-2-enoic acid is sourced from PubChem (CID 22259828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).