About 2-acetyloxyprop-2-enoic acid
2-acetyloxyprop-2-enoic acid (PubChem CID 22259828) has the molecular formula C5H6O4
and a molecular weight of 130.10 g/mol. Its IUPAC name is 2-acetyloxyprop-2-enoic acid.
Molecular Properties
| Compound Name | 2-acetyloxyprop-2-enoic acid |
| PubChem CID | 22259828 |
| Molecular Formula | C5H6O4 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 2-acetyloxyprop-2-enoic acid |
| SMILES | C=C(OC(C)=O)C(=O)O |
| InChI | InChI=1S/C5H6O4/c1-3(5(7)8)9-4(2)6/h1H2,2H3,(H,7,8) |
| InChIKey | CFVZILWIXKITDD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyprop-2-enoic acid?
The IUPAC name of 2-acetyloxyprop-2-enoic acid (CID 22259828) is 2-acetyloxyprop-2-enoic acid.
What is the SMILES notation for 2-acetyloxyprop-2-enoic acid?
The canonical SMILES for 2-acetyloxyprop-2-enoic acid is C=C(OC(C)=O)C(=O)O.
What is the InChIKey of 2-acetyloxyprop-2-enoic acid?
The InChIKey is CFVZILWIXKITDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4/c1-3(5(7)8)9-4(2)6/h1H2,2H3,(H,7,8).
What are the key properties of 2-acetyloxyprop-2-enoic acid?
2-acetyloxyprop-2-enoic acid has a molecular weight of 130.10 g/mol, XLogP of 0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyprop-2-enoic acid is sourced from PubChem (CID 22259828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).