C20H9ClN4O3 — CID 2226028
17-amino-6-chloro-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione (PubChem CID 2226028) has the molecular formula C20H9ClN4O3 and a molecular weight of 388.77 g/mol. Its IUPAC name is 17-amino-6-chloro-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione.
| Compound Name | 17-amino-6-chloro-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
|---|---|
| PubChem CID | 2226028 |
| Molecular Formula | C20H9ClN4O3 |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 17-amino-6-chloro-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-11,16,18-trione |
| SMILES | NN1C(=O)c2ccc3c(=O)n4c5ccc(Cl)cc5nc4c4ccc(c2c34)C1=O |
| InChI | InChI=1S/C20H9ClN4O3/c21-8-1-6-14-13(7-8)23-17-9-2-3-11-16-12(20(28)25(22)19(11)27)5-4-10(15(9)16)18(26)24(14)17/h1-7H,22H2 |
| InChIKey | DOBGAAROTDRFNO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|