C22H28N6O2 — CID 22260308
4-(3-hydroxy-4-methylanilino)-5-methyl-N-(3-pyrrolidin-1-ylpropyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 22260308) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 4-(3-hydroxy-4-methylanilino)-5-methyl-N-(3-pyrrolidin-1-ylpropyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 4-(3-hydroxy-4-methylanilino)-5-methyl-N-(3-pyrrolidin-1-ylpropyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 22260308 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 4-(3-hydroxy-4-methylanilino)-5-methyl-N-(3-pyrrolidin-1-ylpropyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | Cc1ccc(Nc2ncnn3cc(C(=O)NCCCN4CCCC4)c(C)c23)cc1O |
| InChI | InChI=1S/C22H28N6O2/c1-15-6-7-17(12-19(15)29)26-21-20-16(2)18(13-28(20)25-14-24-21)22(30)23-8-5-11-27-9-3-4-10-27/h6-7,12-14,29H,3-5,8-11H2,1-2H3,(H,23,30)(H,24,25,26) |
| InChIKey | UXJIGKZILTVTFH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|