C20H22N8O2 — CID 22260328
4-(3-hydroxy-4-methylanilino)-5-methyl-N-[3-(triazol-2-yl)propyl]pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 22260328) has the molecular formula C20H22N8O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 4-(3-hydroxy-4-methylanilino)-5-methyl-N-[3-(triazol-2-yl)propyl]pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 4-(3-hydroxy-4-methylanilino)-5-methyl-N-[3-(triazol-2-yl)propyl]pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 22260328 |
| Molecular Formula | C20H22N8O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 4-(3-hydroxy-4-methylanilino)-5-methyl-N-[3-(triazol-2-yl)propyl]pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | Cc1ccc(Nc2ncnn3cc(C(=O)NCCCn4nccn4)c(C)c23)cc1O |
| InChI | InChI=1S/C20H22N8O2/c1-13-4-5-15(10-17(13)29)26-19-18-14(2)16(11-27(18)25-12-22-19)20(30)21-6-3-9-28-23-7-8-24-28/h4-5,7-8,10-12,29H,3,6,9H2,1-2H3,(H,21,30)(H,22,25,26) |
| InChIKey | QYBBUCLKBDKNPC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|